Dibutyl 1,8-octanedicarboxylate Details
:
IUPAC Name
Dibutylsebacate
:Chemical Class
:CAS Registry Number
109-43-3
:Description
:Fragrance Type
fruity
Physical and Chemical properties
| PUBCHEM ID |
7986 |
| CAS Registry Number |
0.0 |
| Aroma Threshold |
0.0 |
| Molecular Weight (g/mol) |
314.47 |
| Molecular Formula |
C18H34O4 |
| Hydrogen Bond Donor Count |
0 |
| Hydrogen Bond Acceptor Count |
2 |
| Rotatable Bond Count |
0 |
| IUPAC Name |
Dibutylsebacate |
| Canonical SMILES |
CCCCOC(=O)CCCCCCCCC(=O)OCCCC |
| PUBCHEM IUPAC INCHIKEY |
PYGXAGIECVVIOZ-UHFFFAOYSA-N |
| Solubility Level |
2 |
| Vapour Pressure |
-5.33 |
Absorption and Metabolism information
| XLOGP3 AA |
|
| CACTVS TPSA |
25.78 |
| BBB Level |
0 |
| Absorption Level |
0 |
| EXT PPB#Prediction |
1 |
| AlogP98 |
5.486 |
| EXT CYP2D6#Prediction |
0 |
Toxicological Information
| Mouse Female FDA |
Non-Carcinogen |
| Mouse Male FDA |
Multi-Carcinogen |
| Rat Female FDA |
Single-Carcinogen |
| Rat Male FDA |
Non-Carcinogen |
| Ames Prediction |
Non-Mutagen |
| Developmental / Reproductive Toxicity |
Non-Toxic |
| Rat Oral LD50 |
11.24 |
| Ocular Irritancy |
None |
| Hepatotoxic#Prediction |
0 |
| Effected Human Genes |
NA |
Ecological Information
| Aerobic Biodegradability Prediction |
Degradable |
Hazard(s) Identification
| Physical hazards |
not classified |
| Health hazards |
Mild |
| Environmental hazards |
not classified |
About Table
Headings
Compound Biological Activity