| PUBCHEM ID | 5281443 |
| CAS Registry Number | 0.0 |
| Aroma Threshold | 0.0 |
| Molecular Weight (g/mol) | 390.4 |
| Molecular Formula | C21H26O7 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| IUPAC Name | [(1R,2R,4R,6R,8S,9Z,11R)-8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] 2-methylprop-2-enoate |
| Canonical SMILES | "C/C/1=C/[C@@H]2[C@@H]([C@@H](C[C@@]3([C@H](O3)C[C@@H]1OC(=O)C)C)OC(=O)C(=C)C)C(=C)C(=O)O2 " |
| PUBCHEM IUPAC INCHIKEY | RXIZKFBTUOTBOZ-PTZLTHSXSA-N |
| Solubility Level | 3 |
| Vapour Pressure |
| XLOGP3 AA | 2.2 |
| CACTVS TPSA | 91.4 Ų |
| BBB Level | 3 |
| Absorption Level | 0 |
| EXT PPB#Prediction | TRUE |
| AlogP98 | 2.109 |
| EXT CYP2D6#Prediction | FALSE |
| Mouse Female FDA | Multi-Carcinogen |
| Mouse Male FDA | Multi-Carcinogen |
| Rat Female FDA | Single-Carcinogen |
| Rat Male FDA | Single-Carcinogen |
| Ames Prediction | Non-Mutagen |
| Developmental / Reproductive Toxicity | Non-Toxic |
| Rat Oral LD50 | 0.604115 g/kg_body_weight |
| Ocular Irritancy | Mild |
| Hepatotoxic#Prediction | FALSE |
| Effected Human Genes |
| Aerobic Biodegradability Prediction | Degradable |
| Physical hazards | not classified |
| Health hazards | Mild |
| Environmental hazards | not classified |
| Serial No. | Activity Name | Details | References (PubMed) | Other details EPA (U.S) | Clinical Trials (U.S. NIH) |
|---|---|---|---|---|---|
| 1 | Cytotoxic | 40126263 | Erioflorin acetate |