PUBCHEM ID | 123935 |
Molecular Weight (g/mol) | 217.229 |
Molecular Formula | C8H15N3O4 |
Hydrogen Bond Donor Count | 0 |
Hydrogen Bond Acceptor Count | 1 |
Rotatable Bond Count | 9 |
IUPAC Name | |
Canonical SMILES | C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
PUBCHEM IUPAC INCHIKEY | HJCMDXDYPOUFDY-WHFBIAKZSA-N |
Solubility Level | 5 |
Vapour Pressure | -7.86 |
XLOGP3 AA | NA |
CACTVS TPSA | 17.07 |
BBB Level | 4 |
Absorption Level | 2 |
EXT PPB#Prediction | 0 |
AlogP98 | -2.064 |
EXT CYP2D6#Prediction | 0 |
Mouse Female FDA | Non-Carcinogen |
Mouse Male FDA | Single-Carcinogen |
Rat Female FDA | Non-Carcinogen |
Rat Male FDA | Non-Carcinogen |
Ames Prediction | Non-Mutagen |
Developmental / Reproductive Toxicity | Non-Toxic |
Rat Oral LD50 | 3.71206 |
Ocular Irritancy | Moderate |
Hepatotoxic#Prediction | 1 |
Effected Human Genes | NA |
Aerobic Biodegradability Prediction | Degradable |
Physical hazards | not classified |
Health hazards | None |
Environmental hazards | not classified |
Serial No. | Cas No | Gene Symbol | Organism | Interaction | Interaction Actions | PubMed Id |
---|---|---|---|---|---|---|
1 | 39537-23-0 | CASP8 | Homo sapiens | alanylglutamine inhibits the reaction [tcdA protein, Clostridium difficile results in increased activity of CASP8 protein] | decreases^reaction|increases^activity | 16368960 |
Serial No. | Activity Name | Details | References (PubMed) | Other details EPA (U.S) | Clinical Trials (U.S. NIH) |
---|---|---|---|---|---|
1 | 39537-23-0 | L-Alanyl-L-Glutamine |